About (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one
(5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one (PubChem CID 140682661) has the molecular formula C12H10N2O2S
and a molecular weight of 246.29 g/mol. Its IUPAC name is (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one |
| PubChem CID | 140682661 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)/C(=C/c2ccc3c(c2)CCO3)S1 |
| InChI | InChI=1S/C12H10N2O2S/c13-12-14-11(15)10(17-12)6-7-1-2-9-8(5-7)3-4-16-9/h1-2,5-6H,3-4H2,(H2,13,14,15)/b10-6- |
| InChIKey | GRHRWVRWLAIBGN-POHAHGRESA-N |
| XLogP | 1.76 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one?
The IUPAC name of (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one (CID 140682661) is (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one.
What is the SMILES notation for (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one?
The canonical SMILES for (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one is [H]/N=C1\NC(=O)/C(=C/c2ccc3c(c2)CCO3)S1.
What is the InChIKey of (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one?
The InChIKey is GRHRWVRWLAIBGN-POHAHGRESA-N. The full InChI is InChI=1S/C12H10N2O2S/c13-12-14-11(15)10(17-12)6-7-1-2-9-8(5-7)3-4-16-9/h1-2,5-6H,3-4H2,(H2,13,14,15)/b10-6-.
What are the key properties of (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one?
(5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one has a molecular weight of 246.29 g/mol, XLogP of 1.76, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-2-imino-1,3-thiazolidin-4-one is sourced from PubChem (CID 140682661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).