C15H18F3NO — CID 140683902
3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-ol (PubChem CID 140683902) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is 3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-ol.
| Compound Name | 3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 140683902 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-[[4-(trifluoromethyl)phenyl]methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-ol |
| SMILES | OC1CC2CNC(Cc3ccc(C(F)(F)F)cc3)C2C1 |
| InChI | InChI=1S/C15H18F3NO/c16-15(17,18)11-3-1-9(2-4-11)5-14-13-7-12(20)6-10(13)8-19-14/h1-4,10,12-14,19-20H,5-8H2 |
| InChIKey | RMJQTJUXYPELMH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |