C26H44N2O7S — CID 140684313
oxan-4-yl (3S)-4-acetyl-3-methyl-7-[4-(2-methylsulfonylethoxy)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684313) has the molecular formula C26H44N2O7S and a molecular weight of 528.71 g/mol. Its IUPAC name is oxan-4-yl (3S)-4-acetyl-3-methyl-7-[4-(2-methylsulfonylethoxy)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | oxan-4-yl (3S)-4-acetyl-3-methyl-7-[4-(2-methylsulfonylethoxy)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684313 |
| Molecular Formula | C26H44N2O7S |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | oxan-4-yl (3S)-4-acetyl-3-methyl-7-[4-(2-methylsulfonylethoxy)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C3CCC(OCCS(C)(=O)=O)CC3)CC2N(C(=O)OC2CCOCC2)C[C@@H]1C |
| InChI | InChI=1S/C26H44N2O7S/c1-18-17-27(26(30)35-23-10-12-33-13-11-23)25-16-21(6-9-24(25)28(18)19(2)29)20-4-7-22(8-5-20)34-14-15-36(3,31)32/h18,20-25H,4-17H2,1-3H3/t18-,20?,21?,22?,24?,25?/m0/s1 |
| InChIKey | GAJTZYNTOBWFOT-JKXBWKPASA-N |
| XLogP | 3.01 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |