C25H43N3O7S — CID 140684354
oxan-4-yl (3S)-4-acetyl-7-[3-(methanesulfonamido)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684354) has the molecular formula C25H43N3O7S and a molecular weight of 529.70 g/mol. Its IUPAC name is oxan-4-yl (3S)-4-acetyl-7-[3-(methanesulfonamido)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | oxan-4-yl (3S)-4-acetyl-7-[3-(methanesulfonamido)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684354 |
| Molecular Formula | C25H43N3O7S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | oxan-4-yl (3S)-4-acetyl-7-[3-(methanesulfonamido)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | COC1CCC(C2CCC3C(C2)N(C(=O)OC2CCOCC2)C[C@H](C)N3C(C)=O)CC1NS(C)(=O)=O |
| InChI | InChI=1S/C25H43N3O7S/c1-16-15-27(25(30)35-20-9-11-34-12-10-20)23-14-19(5-7-22(23)28(16)17(2)29)18-6-8-24(33-3)21(13-18)26-36(4,31)32/h16,18-24,26H,5-15H2,1-4H3/t16-,18?,19?,21?,22?,23?,24?/m0/s1 |
| InChIKey | CHTDPEBYPRRRPN-UEOXUCJTSA-N |
| XLogP | 2.12 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |