C26H45N3O5S — CID 140684407
cyclohexyl (3S)-4-acetyl-7-[3-(dimethylsulfamoyl)cyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684407) has the molecular formula C26H45N3O5S and a molecular weight of 511.73 g/mol. Its IUPAC name is cyclohexyl (3S)-4-acetyl-7-[3-(dimethylsulfamoyl)cyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | cyclohexyl (3S)-4-acetyl-7-[3-(dimethylsulfamoyl)cyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684407 |
| Molecular Formula | C26H45N3O5S |
| Molecular Weight | 511.73 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | cyclohexyl (3S)-4-acetyl-7-[3-(dimethylsulfamoyl)cyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C3CCCC(S(=O)(=O)N(C)C)C3)CC2N(C(=O)OC2CCCCC2)C[C@@H]1C |
| InChI | InChI=1S/C26H45N3O5S/c1-18-17-28(26(31)34-22-10-6-5-7-11-22)25-16-21(13-14-24(25)29(18)19(2)30)20-9-8-12-23(15-20)35(32,33)27(3)4/h18,20-25H,5-17H2,1-4H3/t18-,20?,21?,23?,24?,25?/m0/s1 |
| InChIKey | YDNZTKSKBUCSKK-NRRGQSJOSA-N |
| XLogP | 4.00 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.73 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |