C24H41N3O5S — CID 140684417
cyclohexyl (3S)-4-acetyl-3-methyl-7-(3-sulfamoylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684417) has the molecular formula C24H41N3O5S and a molecular weight of 483.68 g/mol. Its IUPAC name is cyclohexyl (3S)-4-acetyl-3-methyl-7-(3-sulfamoylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | cyclohexyl (3S)-4-acetyl-3-methyl-7-(3-sulfamoylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684417 |
| Molecular Formula | C24H41N3O5S |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | cyclohexyl (3S)-4-acetyl-3-methyl-7-(3-sulfamoylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C3CCCC(S(N)(=O)=O)C3)CC2N(C(=O)OC2CCCCC2)C[C@@H]1C |
| InChI | InChI=1S/C24H41N3O5S/c1-16-15-26(24(29)32-20-8-4-3-5-9-20)23-14-19(11-12-22(23)27(16)17(2)28)18-7-6-10-21(13-18)33(25,30)31/h16,18-23H,3-15H2,1-2H3,(H2,25,30,31)/t16-,18?,19?,21?,22?,23?/m0/s1 |
| InChIKey | ASIPZRRTCLLZLO-ZXLPQJLBSA-N |
| XLogP | 3.39 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |