C26H45N3O6S — CID 140684460
cyclohexyl (3S)-4-acetyl-7-[3-(methanesulfonamido)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684460) has the molecular formula C26H45N3O6S and a molecular weight of 527.73 g/mol. Its IUPAC name is cyclohexyl (3S)-4-acetyl-7-[3-(methanesulfonamido)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | cyclohexyl (3S)-4-acetyl-7-[3-(methanesulfonamido)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684460 |
| Molecular Formula | C26H45N3O6S |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | cyclohexyl (3S)-4-acetyl-7-[3-(methanesulfonamido)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | COC1CCC(C2CCC3C(C2)N(C(=O)OC2CCCCC2)C[C@H](C)N3C(C)=O)CC1NS(C)(=O)=O |
| InChI | InChI=1S/C26H45N3O6S/c1-17-16-28(26(31)35-21-8-6-5-7-9-21)24-15-20(10-12-23(24)29(17)18(2)30)19-11-13-25(34-3)22(14-19)27-36(4,32)33/h17,19-25,27H,5-16H2,1-4H3/t17-,19?,20?,22?,23?,24?,25?/m0/s1 |
| InChIKey | PUMHGJBLSGGNKR-MXLUVMSTSA-N |
| XLogP | 3.28 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |