C24H39FN2O6S — CID 140684488
oxan-4-yl (3S)-4-acetyl-7-(3-fluoro-4-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684488) has the molecular formula C24H39FN2O6S and a molecular weight of 502.65 g/mol. Its IUPAC name is oxan-4-yl (3S)-4-acetyl-7-(3-fluoro-4-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | oxan-4-yl (3S)-4-acetyl-7-(3-fluoro-4-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684488 |
| Molecular Formula | C24H39FN2O6S |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | oxan-4-yl (3S)-4-acetyl-7-(3-fluoro-4-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C3CCC(S(C)(=O)=O)C(F)C3)CC2N(C(=O)OC2CCOCC2)C[C@@H]1C |
| InChI | InChI=1S/C24H39FN2O6S/c1-15-14-26(24(29)33-19-8-10-32-11-9-19)22-13-18(4-6-21(22)27(15)16(2)28)17-5-7-23(20(25)12-17)34(3,30)31/h15,17-23H,4-14H2,1-3H3/t15-,17?,18?,20?,21?,22?,23?/m0/s1 |
| InChIKey | JEHKQAQYRNYLHJ-NLVLWVAKSA-N |
| XLogP | 2.94 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |