C23H38FN3O5S — CID 140684508
ethyl (3S)-4-acetyl-7-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-fluorocyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684508) has the molecular formula C23H38FN3O5S and a molecular weight of 487.64 g/mol. Its IUPAC name is ethyl (3S)-4-acetyl-7-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-fluorocyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | ethyl (3S)-4-acetyl-7-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-fluorocyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684508 |
| Molecular Formula | C23H38FN3O5S |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | ethyl (3S)-4-acetyl-7-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-fluorocyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CCOC(=O)N1C[C@H](C)N(C(C)=O)C2CCC(C3CCC(N4CCCS4(=O)=O)C(F)C3)CC21 |
| InChI | InChI=1S/C23H38FN3O5S/c1-4-32-23(29)25-14-15(2)27(16(3)28)21-9-7-18(13-22(21)25)17-6-8-20(19(24)12-17)26-10-5-11-33(26,30)31/h15,17-22H,4-14H2,1-3H3/t15-,17?,18?,19?,20?,21?,22?/m0/s1 |
| InChIKey | SUWJUCVABBXZBB-HHGQWEQISA-N |
| XLogP | 2.78 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |