C18H29F3N2O3S — CID 140684516
1-[(2S)-2-methyl-4-[3-(trifluoromethyl)cyclohexyl]sulfonyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 140684516) has the molecular formula C18H29F3N2O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 1-[(2S)-2-methyl-4-[3-(trifluoromethyl)cyclohexyl]sulfonyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-2-methyl-4-[3-(trifluoromethyl)cyclohexyl]sulfonyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 140684516 |
| Molecular Formula | C18H29F3N2O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 1-[(2S)-2-methyl-4-[3-(trifluoromethyl)cyclohexyl]sulfonyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | CC(=O)N1C2CCCCC2N(S(=O)(=O)C2CCCC(C(F)(F)F)C2)C[C@@H]1C |
| InChI | InChI=1S/C18H29F3N2O3S/c1-12-11-22(16-8-3-4-9-17(16)23(12)13(2)24)27(25,26)15-7-5-6-14(10-15)18(19,20)21/h12,14-17H,3-11H2,1-2H3/t12-,14?,15?,16?,17?/m0/s1 |
| InChIKey | IVLOUOXTJUQYKG-NICGVCSZSA-N |
| XLogP | 3.30 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |