C22H41N3O2 — CID 140684842
1-[(2S)-4-[[3-[2-(dimethylamino)ethoxy]cyclohexyl]methyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 140684842) has the molecular formula C22H41N3O2 and a molecular weight of 379.59 g/mol. Its IUPAC name is 1-[(2S)-4-[[3-[2-(dimethylamino)ethoxy]cyclohexyl]methyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-[[3-[2-(dimethylamino)ethoxy]cyclohexyl]methyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 140684842 |
| Molecular Formula | C22H41N3O2 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.32 |
| IUPAC Name | 1-[(2S)-4-[[3-[2-(dimethylamino)ethoxy]cyclohexyl]methyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | CC(=O)N1C2CCCCC2N(CC2CCCC(OCCN(C)C)C2)C[C@@H]1C |
| InChI | InChI=1S/C22H41N3O2/c1-17-15-24(21-10-5-6-11-22(21)25(17)18(2)26)16-19-8-7-9-20(14-19)27-13-12-23(3)4/h17,19-22H,5-16H2,1-4H3/t17-,19?,20?,21?,22?/m0/s1 |
| InChIKey | IYWHHOTUTUYODI-DTJKJAFUSA-N |
| XLogP | 2.99 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |