C19H34N2O4S — CID 140684883
1-[(2S)-4-(4-methoxy-2-methylcyclohexyl)sulfonyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 140684883) has the molecular formula C19H34N2O4S and a molecular weight of 386.56 g/mol. Its IUPAC name is 1-[(2S)-4-(4-methoxy-2-methylcyclohexyl)sulfonyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-(4-methoxy-2-methylcyclohexyl)sulfonyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 140684883 |
| Molecular Formula | C19H34N2O4S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-[(2S)-4-(4-methoxy-2-methylcyclohexyl)sulfonyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | COC1CCC(S(=O)(=O)N2C[C@H](C)N(C(C)=O)C3CCCCC32)C(C)C1 |
| InChI | InChI=1S/C19H34N2O4S/c1-13-11-16(25-4)9-10-19(13)26(23,24)20-12-14(2)21(15(3)22)18-8-6-5-7-17(18)20/h13-14,16-19H,5-12H2,1-4H3/t13?,14-,16?,17?,18?,19?/m0/s1 |
| InChIKey | FPCHEPKHGJTXCX-LTJPZXNRSA-N |
| XLogP | 2.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |