C21H35FN2O5S — CID 140684913
ethyl (3S)-4-acetyl-7-(4-fluoro-3-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684913) has the molecular formula C21H35FN2O5S and a molecular weight of 446.59 g/mol. Its IUPAC name is ethyl (3S)-4-acetyl-7-(4-fluoro-3-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | ethyl (3S)-4-acetyl-7-(4-fluoro-3-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684913 |
| Molecular Formula | C21H35FN2O5S |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | ethyl (3S)-4-acetyl-7-(4-fluoro-3-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CCOC(=O)N1C[C@H](C)N(C(C)=O)C2CCC(C3CCC(F)C(S(C)(=O)=O)C3)CC21 |
| InChI | InChI=1S/C21H35FN2O5S/c1-5-29-21(26)23-12-13(2)24(14(3)25)18-9-7-15(10-19(18)23)16-6-8-17(22)20(11-16)30(4,27)28/h13,15-20H,5-12H2,1-4H3/t13-,15?,16?,17?,18?,19?,20?/m0/s1 |
| InChIKey | JDJLMTGRJLSLQM-HARDYTLKSA-N |
| XLogP | 2.78 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |