C11H18N4O9 — CID 140685411
(4S,5R,6R,7R,8R)-9-azido-4,6,7,8-tetrahydroxy-5-[(2-hydroxyacetyl)amino]-2-oxononanoic acid (PubChem CID 140685411) has the molecular formula C11H18N4O9 and a molecular weight of 350.28 g/mol. Its IUPAC name is (4S,5R,6R,7R,8R)-9-azido-4,6,7,8-tetrahydroxy-5-[(2-hydroxyacetyl)amino]-2-oxononanoic acid.
| Compound Name | (4S,5R,6R,7R,8R)-9-azido-4,6,7,8-tetrahydroxy-5-[(2-hydroxyacetyl)amino]-2-oxononanoic acid |
|---|---|
| PubChem CID | 140685411 |
| Molecular Formula | C11H18N4O9 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (4S,5R,6R,7R,8R)-9-azido-4,6,7,8-tetrahydroxy-5-[(2-hydroxyacetyl)amino]-2-oxononanoic acid |
| SMILES | [N-]=[N+]=NC[C@@H](O)[C@@H](O)[C@H](O)[C@H](NC(=O)CO)[C@@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C11H18N4O9/c12-15-13-2-6(19)9(21)10(22)8(14-7(20)3-16)4(17)1-5(18)11(23)24/h4,6,8-10,16-17,19,21-22H,1-3H2,(H,14,20)(H,23,24)/t4-,6+,8+,9+,10+/m0/s1 |
| InChIKey | YZWRZAFNPCZPGE-KQCZLNONSA-N |
| XLogP | -3.74 |
| TPSA | 233.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|