C20H30N4O3 — CID 140685435
4,7-bis(2-methylpropyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (PubChem CID 140685435) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 4,7-bis(2-methylpropyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | 4,7-bis(2-methylpropyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 140685435 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 4,7-bis(2-methylpropyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| SMILES | CC(C)CC1CCN(CC(C)C)C2Cn3cc(C(N)=O)c(=O)cc3C(=O)N12 |
| InChI | InChI=1S/C20H30N4O3/c1-12(2)7-14-5-6-22(9-13(3)4)18-11-23-10-15(19(21)26)17(25)8-16(23)20(27)24(14)18/h8,10,12-14,18H,5-7,9,11H2,1-4H3,(H2,21,26) |
| InChIKey | HIJBNGMVFCPFJA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |