C32H34FN3O5SSi — CID 140685692
[4-[3,4-bis(hydroxymethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-[6-(7-fluoro-1-benzothiophen-3-yl)-5-methoxy-2-pyridinyl]methanone (PubChem CID 140685692) has the molecular formula C32H34FN3O5SSi and a molecular weight of 619.79 g/mol. Its IUPAC name is [4-[3,4-bis(hydroxymethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-[6-(7-fluoro-1-benzothiophen-3-yl)-5-methoxy-2-pyridinyl]methanone.
| Compound Name | [4-[3,4-bis(hydroxymethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-[6-(7-fluoro-1-benzothiophen-3-yl)-5-methoxy-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 140685692 |
| Molecular Formula | C32H34FN3O5SSi |
| Molecular Weight | 619.79 g/mol |
| Exact Mass | 619.20 |
| IUPAC Name | [4-[3,4-bis(hydroxymethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-[6-(7-fluoro-1-benzothiophen-3-yl)-5-methoxy-2-pyridinyl]methanone |
| SMILES | COc1ccc(C(=O)c2nc(-c3ccc(CO)c(CO)c3)cn2COCC[Si](C)(C)C)nc1-c1csc2c(F)cccc12 |
| InChI | InChI=1S/C32H34FN3O5SSi/c1-40-28-11-10-26(34-29(28)24-18-42-31-23(24)6-5-7-25(31)33)30(39)32-35-27(15-36(32)19-41-12-13-43(2,3)4)20-8-9-21(16-37)22(14-20)17-38/h5-11,14-15,18,37-38H,12-13,16-17,19H2,1-4H3 |
| InChIKey | LQUWOZPZERQTPX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|