C26H18N2 — CID 140686487
2-isocyano-9-methyl-6-(3-phenylphenyl)carbazole (PubChem CID 140686487) has the molecular formula C26H18N2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-isocyano-9-methyl-6-(3-phenylphenyl)carbazole.
| Compound Name | 2-isocyano-9-methyl-6-(3-phenylphenyl)carbazole |
|---|---|
| PubChem CID | 140686487 |
| Molecular Formula | C26H18N2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-isocyano-9-methyl-6-(3-phenylphenyl)carbazole |
| SMILES | [C-]#[N+]c1ccc2c3cc(-c4cccc(-c5ccccc5)c4)ccc3n(C)c2c1 |
| InChI | InChI=1S/C26H18N2/c1-27-22-12-13-23-24-16-21(11-14-25(24)28(2)26(23)17-22)20-10-6-9-19(15-20)18-7-4-3-5-8-18/h3-17H,2H3 |
| InChIKey | AZAHAERZLYENBB-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 9.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|