C25H28F3N3OS — CID 140687256
4-[6-(4,5-dimethylfuran-3-yl)-4-(3-hexylthiophen-2-yl)-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine (PubChem CID 140687256) has the molecular formula C25H28F3N3OS and a molecular weight of 475.58 g/mol. Its IUPAC name is 4-[6-(4,5-dimethylfuran-3-yl)-4-(3-hexylthiophen-2-yl)-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine.
| Compound Name | 4-[6-(4,5-dimethylfuran-3-yl)-4-(3-hexylthiophen-2-yl)-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine |
|---|---|
| PubChem CID | 140687256 |
| Molecular Formula | C25H28F3N3OS |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 4-[6-(4,5-dimethylfuran-3-yl)-4-(3-hexylthiophen-2-yl)-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine |
| SMILES | [H]/N=C(\C=C(N)C(F)(F)F)c1cc(-c2sccc2CCCCCC)cc(-c2coc(C)c2C)n1 |
| InChI | InChI=1S/C25H28F3N3OS/c1-4-5-6-7-8-17-9-10-33-24(17)18-11-21(19-14-32-16(3)15(19)2)31-22(12-18)20(29)13-23(30)25(26,27)28/h9-14,29H,4-8,30H2,1-3H3/b23-13?,29-20+ |
| InChIKey | FQVWWEYXXRSBCJ-DCLLJTEFSA-N |
| XLogP | 7.58 |
| TPSA | 75.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|