C18H34O4 — CID 140687751
[(2R,3R,4R,5S)-3,4-dimethoxy-5-undec-10-en-2-yloxolan-2-yl]methanol (PubChem CID 140687751) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-dimethoxy-5-undec-10-en-2-yloxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5S)-3,4-dimethoxy-5-undec-10-en-2-yloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 140687751 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-dimethoxy-5-undec-10-en-2-yloxolan-2-yl]methanol |
| SMILES | C=CCCCCCCCC(C)[C@@H]1O[C@H](CO)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C18H34O4/c1-5-6-7-8-9-10-11-12-14(2)16-18(21-4)17(20-3)15(13-19)22-16/h5,14-19H,1,6-13H2,2-4H3/t14?,15-,16+,17-,18-/m1/s1 |
| InChIKey | ARNBCBXZXQAXIF-PYWTVGQWSA-N |
| XLogP | 3.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|