About CID 140687808
CID 140687808 (PubChem CID 140687808) has the molecular formula C53H61IrN5-2
and a molecular weight of 965.35 g/mol.
Molecular Properties
| Compound Name | CID 140687808 |
| PubChem CID | 140687808 |
| Molecular Formula | C53H61IrN5-2 |
| Molecular Weight | 965.35 g/mol |
| Exact Mass | 965.49 |
| IUPAC Name | — |
| SMILES | [2H]c1[c-]c2c(nc(C(C)(C)C)n3c4cc5c(cc4nc23)C(C)(C)CC5(C)C)c([2H])c1[2H].[2H]c1c2c(c([2H])c3c1nc1c4[c-]cccc4cc(C(C)(C)C)n13)C(C)(C)C(C)(C)C2(C)C.[Ir] |
| InChI | InChI=1S/C28H33N2.C25H28N3.Ir/c1-25(2,3)23-14-17-12-10-11-13-18(17)24-29-21-15-19-20(16-22(21)30(23)24)27(6,7)28(8,9)26(19,4)5;1-23(2,3)22-27-18-11-9-8-10-15(18)21-26-19-12-16-17(13-20(19)28(21)22)25(6,7)14-24(16,4)5;/h10-12,14-16H,1-9H3;8-9,11-13H,14H2,1-7H3;/q2*-1;/i15D,16D;8D,9D,11D; |
| InChIKey | ZCGKDSRYQQCWKT-WVSIUUGYSA-N |
| XLogP | 13.42 |
| TPSA | 47.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 965.35 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 140687808 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140687808?
The IUPAC name of CID 140687808 (CID 140687808) is not available.
What is the SMILES notation for CID 140687808?
The canonical SMILES for CID 140687808 is [2H]c1[c-]c2c(nc(C(C)(C)C)n3c4cc5c(cc4nc23)C(C)(C)CC5(C)C)c([2H])c1[2H].[2H]c1c2c(c([2H])c3c1nc1c4[c-]cccc4cc(C(C)(C)C)n13)C(C)(C)C(C)(C)C2(C)C.[Ir].
What is the InChIKey of CID 140687808?
The InChIKey is ZCGKDSRYQQCWKT-WVSIUUGYSA-N. The full InChI is InChI=1S/C28H33N2.C25H28N3.Ir/c1-25(2,3)23-14-17-12-10-11-13-18(17)24-29-21-15-19-20(16-22(21)30(23)24)27(6,7)28(8,9)26(19,4)5;1-23(2,3)22-27-18-11-9-8-10-15(18)21-26-19-12-16-17(13-20(19)28(21)22)25(6,7)14-24(16,4)5;/h10-12,14-16H,1-9H3;8-9,11-13H,14H2,1-7H3;/q2*-1;/i15D,16D;8D,9D,11D;.
What are the key properties of CID 140687808?
CID 140687808 has a molecular weight of 965.35 g/mol, XLogP of 13.42, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140687808 is sourced from PubChem (CID 140687808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).