About CID 140687864
CID 140687864 (PubChem CID 140687864) has the molecular formula C50H51IrN5O-2
and a molecular weight of 930.21 g/mol.
Molecular Properties
| Compound Name | CID 140687864 |
| PubChem CID | 140687864 |
| Molecular Formula | C50H51IrN5O-2 |
| Molecular Weight | 930.21 g/mol |
| Exact Mass | 930.37 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2cc3nc(C(C)(C)C)c[c-]c3c3nc4cc5c(cc4n23)C(C)(C)OC5(C)C)c(C)c1.Cc1cccc(C)c1-n1ccnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C33H36N3O.C17H15N2.Ir/c1-18-13-19(2)29(20(3)14-18)27-17-24-21(11-12-28(34-24)31(4,5)6)30-35-25-15-22-23(16-26(25)36(27)30)33(9,10)37-32(22,7)8;1-13-7-6-8-14(2)16(13)19-12-11-18-17(19)15-9-4-3-5-10-15;/h12-17H,1-10H3;3-9,11-12H,1-2H3;/q2*-1; |
| InChIKey | IUTHAMVFFBVEBL-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 930.21 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 140687864 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140687864?
The IUPAC name of CID 140687864 (CID 140687864) is not available.
What is the SMILES notation for CID 140687864?
The canonical SMILES for CID 140687864 is Cc1cc(C)c(-c2cc3nc(C(C)(C)C)c[c-]c3c3nc4cc5c(cc4n23)C(C)(C)OC5(C)C)c(C)c1.Cc1cccc(C)c1-n1ccnc1-c1[c-]cccc1.[Ir].
What is the InChIKey of CID 140687864?
The InChIKey is IUTHAMVFFBVEBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H36N3O.C17H15N2.Ir/c1-18-13-19(2)29(20(3)14-18)27-17-24-21(11-12-28(34-24)31(4,5)6)30-35-25-15-22-23(16-26(25)36(27)30)33(9,10)37-32(22,7)8;1-13-7-6-8-14(2)16(13)19-12-11-18-17(19)15-9-4-3-5-10-15;/h12-17H,1-10H3;3-9,11-12H,1-2H3;/q2*-1;.
What are the key properties of CID 140687864?
CID 140687864 has a molecular weight of 930.21 g/mol, XLogP of 12.18, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140687864 is sourced from PubChem (CID 140687864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).