C16H26O3 — CID 140688066
1-(2,5-dimethyl-3-oxohex-5-enoxy)-2,5-dimethylhex-5-en-3-one (PubChem CID 140688066) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-(2,5-dimethyl-3-oxohex-5-enoxy)-2,5-dimethylhex-5-en-3-one.
| Compound Name | 1-(2,5-dimethyl-3-oxohex-5-enoxy)-2,5-dimethylhex-5-en-3-one |
|---|---|
| PubChem CID | 140688066 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-(2,5-dimethyl-3-oxohex-5-enoxy)-2,5-dimethylhex-5-en-3-one |
| SMILES | C=C(C)CC(=O)C(C)COCC(C)C(=O)CC(=C)C |
| InChI | InChI=1S/C16H26O3/c1-11(2)7-15(17)13(5)9-19-10-14(6)16(18)8-12(3)4/h13-14H,1,3,7-10H2,2,4-6H3 |
| InChIKey | OYBITXQTVQDAFA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|