About 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine
7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine (PubChem CID 140688206) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine.
Molecular Properties
| Compound Name | 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine |
| PubChem CID | 140688206 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine |
| SMILES | CC1(N)C2=CC=C1C=C2 |
| InChI | InChI=1S/C8H9N/c1-8(9)6-2-3-7(8)5-4-6/h2-5H,9H2,1H3 |
| InChIKey | WNNFZSDCVJWJIV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine?
The IUPAC name of 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine (CID 140688206) is 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine.
What is the SMILES notation for 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine?
The canonical SMILES for 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine is CC1(N)C2=CC=C1C=C2.
What is the InChIKey of 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine?
The InChIKey is WNNFZSDCVJWJIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-8(9)6-2-3-7(8)5-4-6/h2-5H,9H2,1H3.
What are the key properties of 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine?
7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine has a molecular weight of 119.17 g/mol, XLogP of 1.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylbicyclo[2.2.1]hepta-1,3,5-trien-7-amine is sourced from PubChem (CID 140688206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).