C17H14IrN2O2P- — CID 140688498
2,3-dimethyl-5-phenyl-10H-imidazo[1,2-c][1,3,2]benzoxazaphosphinin-10-ide 5-oxide;iridium (PubChem CID 140688498) has the molecular formula C17H14IrN2O2P- and a molecular weight of 501.50 g/mol. Its IUPAC name is 2,3-dimethyl-5-phenyl-10H-imidazo[1,2-c][1,3,2]benzoxazaphosphinin-10-ide 5-oxide;iridium.
| Compound Name | 2,3-dimethyl-5-phenyl-10H-imidazo[1,2-c][1,3,2]benzoxazaphosphinin-10-ide 5-oxide;iridium |
|---|---|
| PubChem CID | 140688498 |
| Molecular Formula | C17H14IrN2O2P- |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 2,3-dimethyl-5-phenyl-10H-imidazo[1,2-c][1,3,2]benzoxazaphosphinin-10-ide 5-oxide;iridium |
| SMILES | Cc1nc2n(c1C)P(=O)(c1ccccc1)Oc1ccc[c-]c1-2.[Ir] |
| InChI | InChI=1S/C17H14N2O2P.Ir/c1-12-13(2)19-17(18-12)15-10-6-7-11-16(15)21-22(19,20)14-8-4-3-5-9-14;/h3-9,11H,1-2H3;/q-1; |
| InChIKey | QLFAIQPKGLXPEE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|