C13H17N3O2 — CID 14068971
6,7-dimethoxy-3-N,3-N-dimethylisoquinoline-1,3-diamine (PubChem CID 14068971) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 6,7-dimethoxy-3-N,3-N-dimethylisoquinoline-1,3-diamine.
| Compound Name | 6,7-dimethoxy-3-N,3-N-dimethylisoquinoline-1,3-diamine |
|---|---|
| PubChem CID | 14068971 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 6,7-dimethoxy-3-N,3-N-dimethylisoquinoline-1,3-diamine |
| SMILES | COc1cc2cc(N(C)C)nc(N)c2cc1OC |
| InChI | InChI=1S/C13H17N3O2/c1-16(2)12-6-8-5-10(17-3)11(18-4)7-9(8)13(14)15-12/h5-7H,1-4H3,(H2,14,15) |
| InChIKey | MVIBRSRSKGBEJE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |