C24H39ClN2O3 — CID 140689777
5-[(3-chlorocyclohexanecarbonyl)amino]-2-(3-cyclohexylpyrrolidin-1-yl)cyclohexane-1-carboxylic acid (PubChem CID 140689777) has the molecular formula C24H39ClN2O3 and a molecular weight of 439.04 g/mol. Its IUPAC name is 5-[(3-chlorocyclohexanecarbonyl)amino]-2-(3-cyclohexylpyrrolidin-1-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 5-[(3-chlorocyclohexanecarbonyl)amino]-2-(3-cyclohexylpyrrolidin-1-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 140689777 |
| Molecular Formula | C24H39ClN2O3 |
| Molecular Weight | 439.04 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 5-[(3-chlorocyclohexanecarbonyl)amino]-2-(3-cyclohexylpyrrolidin-1-yl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1CCC(N2CCC(C3CCCCC3)C2)C(C(=O)O)C1)C1CCCC(Cl)C1 |
| InChI | InChI=1S/C24H39ClN2O3/c25-19-8-4-7-17(13-19)23(28)26-20-9-10-22(21(14-20)24(29)30)27-12-11-18(15-27)16-5-2-1-3-6-16/h16-22H,1-15H2,(H,26,28)(H,29,30) |
| InChIKey | XAQRFIATAPPTOB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.04 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|