C19H25N5O3 — CID 14069009
4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-prop-2-enylpiperazine-1-carboxamide (PubChem CID 14069009) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-prop-2-enylpiperazine-1-carboxamide.
| Compound Name | 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-prop-2-enylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 14069009 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-prop-2-enylpiperazine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCN(c2cc(N)c3cc(OC)c(OC)cc3n2)CC1 |
| InChI | InChI=1S/C19H25N5O3/c1-4-5-21-19(25)24-8-6-23(7-9-24)18-11-14(20)13-10-16(26-2)17(27-3)12-15(13)22-18/h4,10-12H,1,5-9H2,2-3H3,(H2,20,22)(H,21,25) |
| InChIKey | VGZMVZACTDGXOS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|