About 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide
4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide (PubChem CID 14069011) has the molecular formula C22H25N5O3
and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide |
| PubChem CID | 14069011 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide |
| SMILES | COc1cc2nc(N3CCN(C(=O)Nc4ccccc4)CC3)cc(N)c2cc1OC |
| InChI | InChI=1S/C22H25N5O3/c1-29-19-12-16-17(23)13-21(25-18(16)14-20(19)30-2)26-8-10-27(11-9-26)22(28)24-15-6-4-3-5-7-15/h3-7,12-14H,8-11H2,1-2H3,(H2,23,25)(H,24,28) |
| InChIKey | ZXUNSNIDDUGAHL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide?
The IUPAC name of 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide (CID 14069011) is 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide.
What is the SMILES notation for 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide?
The canonical SMILES for 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide is COc1cc2nc(N3CCN(C(=O)Nc4ccccc4)CC3)cc(N)c2cc1OC.
What is the InChIKey of 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide?
The InChIKey is ZXUNSNIDDUGAHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5O3/c1-29-19-12-16-17(23)13-21(25-18(16)14-20(19)30-2)26-8-10-27(11-9-26)22(28)24-15-6-4-3-5-7-15/h3-7,12-14H,8-11H2,1-2H3,(H2,23,25)(H,24,28).
What are the key properties of 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide?
4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide has a molecular weight of 407.47 g/mol, XLogP of 3.19, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-6,7-dimethoxyquinolin-2-yl)-N-phenylpiperazine-1-carboxamide is sourced from PubChem (CID 14069011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).