About 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene
3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene (PubChem CID 14069176) has the molecular formula C16H14S2
and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene.
Molecular Properties
| Compound Name | 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene |
| PubChem CID | 14069176 |
| Molecular Formula | C16H14S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene |
| SMILES | C=C(Sc1ccccc1)C(=C)Sc1ccccc1 |
| InChI | InChI=1S/C16H14S2/c1-13(17-15-9-5-3-6-10-15)14(2)18-16-11-7-4-8-12-16/h3-12H,1-2H2 |
| InChIKey | PQZKGLSKLMZGSV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene?
The IUPAC name of 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene (CID 14069176) is 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene.
What is the SMILES notation for 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene?
The canonical SMILES for 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene is C=C(Sc1ccccc1)C(=C)Sc1ccccc1.
What is the InChIKey of 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene?
The InChIKey is PQZKGLSKLMZGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14S2/c1-13(17-15-9-5-3-6-10-15)14(2)18-16-11-7-4-8-12-16/h3-12H,1-2H2.
What are the key properties of 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene?
3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene has a molecular weight of 270.42 g/mol, XLogP of 5.60, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylsulfanylbuta-1,3-dien-2-ylsulfanylbenzene is sourced from PubChem (CID 14069176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).