C29H35O4S+ — CID 140692070
3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-[4-(4-propoxyphenoxy)naphthalen-1-yl]butan-1-one (PubChem CID 140692070) has the molecular formula C29H35O4S+ and a molecular weight of 479.66 g/mol. Its IUPAC name is 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-[4-(4-propoxyphenoxy)naphthalen-1-yl]butan-1-one.
| Compound Name | 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-[4-(4-propoxyphenoxy)naphthalen-1-yl]butan-1-one |
|---|---|
| PubChem CID | 140692070 |
| Molecular Formula | C29H35O4S+ |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-[4-(4-propoxyphenoxy)naphthalen-1-yl]butan-1-one |
| SMILES | CCCOc1ccc(Oc2ccc(C(=O)C([S+]3CCOCC3)C(C)(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C29H35O4S/c1-5-16-32-21-10-12-22(13-11-21)33-26-15-14-25(23-8-6-7-9-24(23)26)27(30)28(29(2,3)4)34-19-17-31-18-20-34/h6-15,28H,5,16-20H2,1-4H3/q+1 |
| InChIKey | JWKKIGFWYYUTEA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|