C28H33O5S+ — CID 140692075
1-[4-(2,4-dimethoxyphenoxy)naphthalen-1-yl]-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one (PubChem CID 140692075) has the molecular formula C28H33O5S+ and a molecular weight of 481.63 g/mol. Its IUPAC name is 1-[4-(2,4-dimethoxyphenoxy)naphthalen-1-yl]-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one.
| Compound Name | 1-[4-(2,4-dimethoxyphenoxy)naphthalen-1-yl]-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one |
|---|---|
| PubChem CID | 140692075 |
| Molecular Formula | C28H33O5S+ |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 1-[4-(2,4-dimethoxyphenoxy)naphthalen-1-yl]-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one |
| SMILES | COc1ccc(Oc2ccc(C(=O)C([S+]3CCOCC3)C(C)(C)C)c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C28H33O5S/c1-28(2,3)27(34-16-14-32-15-17-34)26(29)22-11-13-23(21-9-7-6-8-20(21)22)33-24-12-10-19(30-4)18-25(24)31-5/h6-13,18,27H,14-17H2,1-5H3/q+1 |
| InChIKey | LYHSJBMVVVQFKS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|