C31H33O4S+ — CID 140692110
1-[4-(6-methoxynaphthalen-2-yl)oxynaphthalen-1-yl]-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one (PubChem CID 140692110) has the molecular formula C31H33O4S+ and a molecular weight of 501.67 g/mol. Its IUPAC name is 1-[4-(6-methoxynaphthalen-2-yl)oxynaphthalen-1-yl]-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one.
| Compound Name | 1-[4-(6-methoxynaphthalen-2-yl)oxynaphthalen-1-yl]-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one |
|---|---|
| PubChem CID | 140692110 |
| Molecular Formula | C31H33O4S+ |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 1-[4-(6-methoxynaphthalen-2-yl)oxynaphthalen-1-yl]-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one |
| SMILES | COc1ccc2cc(Oc3ccc(C(=O)C([S+]4CCOCC4)C(C)(C)C)c4ccccc34)ccc2c1 |
| InChI | InChI=1S/C31H33O4S/c1-31(2,3)30(36-17-15-34-16-18-36)29(32)27-13-14-28(26-8-6-5-7-25(26)27)35-24-12-10-21-19-23(33-4)11-9-22(21)20-24/h5-14,19-20,30H,15-18H2,1-4H3/q+1 |
| InChIKey | KLGNPYHYXCDZAN-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|