C14H26O5Si — CID 140692329
2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetic acid (PubChem CID 140692329) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetic acid.
| Compound Name | 2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetic acid |
|---|---|
| PubChem CID | 140692329 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-[(3aR,6R,6aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CO[C@@H]2C(CC(=O)O)CO[C@@H]21 |
| InChI | InChI=1S/C14H26O5Si/c1-14(2,3)20(4,5)19-10-8-18-12-9(6-11(15)16)7-17-13(10)12/h9-10,12-13H,6-8H2,1-5H3,(H,15,16)/t9?,10-,12-,13-/m1/s1 |
| InChIKey | PMKWNZGOOVKYDN-RDYWYGHXSA-N |
| XLogP | 2.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|