C22H23BF3NO2 — CID 140692820
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole (PubChem CID 140692820) has the molecular formula C22H23BF3NO2 and a molecular weight of 401.24 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole |
|---|---|
| PubChem CID | 140692820 |
| Molecular Formula | C22H23BF3NO2 |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]indole |
| SMILES | CC1(C)OB(c2ccc3c(ccn3Cc3ccc(C(F)(F)F)cc3)c2)OC1(C)C |
| InChI | InChI=1S/C22H23BF3NO2/c1-20(2)21(3,4)29-23(28-20)18-9-10-19-16(13-18)11-12-27(19)14-15-5-7-17(8-6-15)22(24,25)26/h5-13H,14H2,1-4H3 |
| InChIKey | UHYVBLKZXDUQCT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|