C10H20N4S2 — CID 14069300
1-N,3-N-diethyl-1,3-diazinane-1,3-dicarbothioamide (PubChem CID 14069300) has the molecular formula C10H20N4S2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 1-N,3-N-diethyl-1,3-diazinane-1,3-dicarbothioamide.
| Compound Name | 1-N,3-N-diethyl-1,3-diazinane-1,3-dicarbothioamide |
|---|---|
| PubChem CID | 14069300 |
| Molecular Formula | C10H20N4S2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-N,3-N-diethyl-1,3-diazinane-1,3-dicarbothioamide |
| SMILES | CCNC(=S)N1CCCN(C(=S)NCC)C1 |
| InChI | InChI=1S/C10H20N4S2/c1-3-11-9(15)13-6-5-7-14(8-13)10(16)12-4-2/h3-8H2,1-2H3,(H,11,15)(H,12,16) |
| InChIKey | SUCHIJKFBNJAHS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|