C45H39BF9N9O9 — CID 140693371
tris[2-(difluoromethyl)-4-fluoro-6-[[(1S,2S)-2-(5-methoxy-2-pyridinyl)cyclopropyl]methoxy]pyrimidin-5-yl] borate (PubChem CID 140693371) has the molecular formula C45H39BF9N9O9 and a molecular weight of 1031.65 g/mol. Its IUPAC name is tris[2-(difluoromethyl)-4-fluoro-6-[[(1S,2S)-2-(5-methoxy-2-pyridinyl)cyclopropyl]methoxy]pyrimidin-5-yl] borate.
| Compound Name | tris[2-(difluoromethyl)-4-fluoro-6-[[(1S,2S)-2-(5-methoxy-2-pyridinyl)cyclopropyl]methoxy]pyrimidin-5-yl] borate |
|---|---|
| PubChem CID | 140693371 |
| Molecular Formula | C45H39BF9N9O9 |
| Molecular Weight | 1031.65 g/mol |
| Exact Mass | 1031.28 |
| IUPAC Name | tris[2-(difluoromethyl)-4-fluoro-6-[[(1S,2S)-2-(5-methoxy-2-pyridinyl)cyclopropyl]methoxy]pyrimidin-5-yl] borate |
| SMILES | COc1ccc([C@H]2C[C@@H]2COc2nc(C(F)F)nc(F)c2OB(Oc2c(F)nc(C(F)F)nc2OC[C@H]2C[C@@H]2c2ccc(OC)cn2)Oc2c(F)nc(C(F)F)nc2OC[C@H]2C[C@@H]2c2ccc(OC)cn2)nc1 |
| InChI | InChI=1S/C45H39BF9N9O9/c1-65-22-4-7-28(56-13-22)25-10-19(25)16-68-43-31(37(53)59-40(62-43)34(47)48)71-46(72-32-38(54)60-41(35(49)50)63-44(32)69-17-20-11-26(20)29-8-5-23(66-2)14-57-29)73-33-39(55)61-42(36(51)52)64-45(33)70-18-21-12-27(21)30-9-6-24(67-3)15-58-30/h4-9,13-15,19-21,25-27,34-36H,10-12,16-18H2,1-3H3/t19-,20-,21-,25+,26+,27+/m1/s1 |
| InChIKey | UPBHTKRVGFNYFW-KWOOVMAGSA-N |
| XLogP | 8.57 |
| TPSA | 199.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.65 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|