C16H19F6O3S- — CID 140694094
2,2,3,3,4,4-hexafluoro-4-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)butane-1-sulfonate (PubChem CID 140694094) has the molecular formula C16H19F6O3S- and a molecular weight of 405.38 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-4-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)butane-1-sulfonate.
| Compound Name | 2,2,3,3,4,4-hexafluoro-4-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)butane-1-sulfonate |
|---|---|
| PubChem CID | 140694094 |
| Molecular Formula | C16H19F6O3S- |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-4-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)butane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(F)(F)C(F)(F)C(F)(F)C1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C16H20F6O3S/c17-14(18,6-26(23,24)25)16(21,22)15(19,20)11-5-9-4-10(11)13-8-2-1-7(3-8)12(9)13/h7-13H,1-6H2,(H,23,24,25)/p-1 |
| InChIKey | ZADIMZZGYOXUMX-UHFFFAOYSA-M |
| XLogP | 3.76 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|