3-iodopropanoyl chloride

C3H4ClIO — CID 14069454

IUPAC3-iodopropanoyl chloride
SMILESO=C(Cl)CCI
InChIInChI=1S/C3H4ClIO/c4-3(6)1-2-5/h1-2H2
InChIKeyBVGKKICUUAFHFE-UHFFFAOYSA-N
MW218.42 g/mol
LogP1.58
Rot. Bonds2

About 3-iodopropanoyl chloride

3-iodopropanoyl chloride (PubChem CID 14069454) has the molecular formula C3H4ClIO and a molecular weight of 218.42 g/mol. Its IUPAC name is 3-iodopropanoyl chloride.

Molecular Properties

Compound Name3-iodopropanoyl chloride
PubChem CID14069454
Molecular FormulaC3H4ClIO
Molecular Weight218.42 g/mol
Exact Mass217.90
IUPAC Name3-iodopropanoyl chloride
SMILESO=C(Cl)CCI
InChIInChI=1S/C3H4ClIO/c4-3(6)1-2-5/h1-2H2
InChIKeyBVGKKICUUAFHFE-UHFFFAOYSA-N
XLogP1.58
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.42
LogP ≤ 51.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 3-iodopropanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-iodopropanoyl chloride?
The IUPAC name of 3-iodopropanoyl chloride (CID 14069454) is 3-iodopropanoyl chloride.
What is the SMILES notation for 3-iodopropanoyl chloride?
The canonical SMILES for 3-iodopropanoyl chloride is O=C(Cl)CCI.
What is the InChIKey of 3-iodopropanoyl chloride?
The InChIKey is BVGKKICUUAFHFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4ClIO/c4-3(6)1-2-5/h1-2H2.
What are the key properties of 3-iodopropanoyl chloride?
3-iodopropanoyl chloride has a molecular weight of 218.42 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodopropanoyl chloride is sourced from PubChem (CID 14069454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).