C7H15BO2 — CID 140694586
4,4,5,5-tetramethyl-2-(trideuteriomethyl)-1,3,2-dioxaborolane (PubChem CID 140694586) has the molecular formula C7H15BO2 and a molecular weight of 145.03 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(trideuteriomethyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(trideuteriomethyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140694586 |
| Molecular Formula | C7H15BO2 |
| Molecular Weight | 145.03 g/mol |
| Exact Mass | 145.14 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(trideuteriomethyl)-1,3,2-dioxaborolane |
| SMILES | [2H]C([2H])([2H])B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C7H15BO2/c1-6(2)7(3,4)10-8(5)9-6/h1-5H3/i5D3 |
| InChIKey | FOQJHZPURACERJ-VPYROQPTSA-N |
| XLogP | 1.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.03 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|