About cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine)
cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine) (PubChem CID 140695184) has the molecular formula C30H28CoN8+2
and a molecular weight of 559.54 g/mol. Its IUPAC name is cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine).
Molecular Properties
| Compound Name | cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine) |
| PubChem CID | 140695184 |
| Molecular Formula | C30H28CoN8+2 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine) |
| SMILES | Cc1ccnc(-c2cc(C)cc(-n3cccn3)n2)c1.Cc1ccnc(-c2cc(C)cc(-n3cccn3)n2)c1.[Co+2] |
| InChI | InChI=1S/2C15H14N4.Co/c2*1-11-4-6-16-13(8-11)14-9-12(2)10-15(18-14)19-7-3-5-17-19;/h2*3-10H,1-2H3;/q;;+2 |
| InChIKey | OZAUWOYNTNRGQA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine)?
The IUPAC name of cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine) (CID 140695184) is cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine).
What is the SMILES notation for cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine)?
The canonical SMILES for cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine) is Cc1ccnc(-c2cc(C)cc(-n3cccn3)n2)c1.Cc1ccnc(-c2cc(C)cc(-n3cccn3)n2)c1.[Co+2].
What is the InChIKey of cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine)?
The InChIKey is OZAUWOYNTNRGQA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H14N4.Co/c2*1-11-4-6-16-13(8-11)14-9-12(2)10-15(18-14)19-7-3-5-17-19;/h2*3-10H,1-2H3;/q;;+2.
What are the key properties of cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine)?
cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine) has a molecular weight of 559.54 g/mol, XLogP of 5.89, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis(4-methyl-2-(4-methyl-2-pyridinyl)-6-pyrazol-1-ylpyridine) is sourced from PubChem (CID 140695184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).