About cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine)
cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine) (PubChem CID 140695192) has the molecular formula C34H36CoN8+3
and a molecular weight of 615.65 g/mol. Its IUPAC name is cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine).
Molecular Properties
| Compound Name | cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine) |
| PubChem CID | 140695192 |
| Molecular Formula | C34H36CoN8+3 |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine) |
| SMILES | Cc1ccnc(-c2cc(C)cc(-n3nc(C)cc3C)n2)c1.Cc1ccnc(-c2cc(C)cc(-n3nc(C)cc3C)n2)c1.[Co+3] |
| InChI | InChI=1S/2C17H18N4.Co/c2*1-11-5-6-18-15(7-11)16-8-12(2)9-17(19-16)21-14(4)10-13(3)20-21;/h2*5-10H,1-4H3;/q;;+3 |
| InChIKey | FTGFNTALDHNIJI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine)?
The IUPAC name of cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine) (CID 140695192) is cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine).
What is the SMILES notation for cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine)?
The canonical SMILES for cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine) is Cc1ccnc(-c2cc(C)cc(-n3nc(C)cc3C)n2)c1.Cc1ccnc(-c2cc(C)cc(-n3nc(C)cc3C)n2)c1.[Co+3].
What is the InChIKey of cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine)?
The InChIKey is FTGFNTALDHNIJI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H18N4.Co/c2*1-11-5-6-18-15(7-11)16-8-12(2)9-17(19-16)21-14(4)10-13(3)20-21;/h2*5-10H,1-4H3;/q;;+3.
What are the key properties of cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine)?
cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine) has a molecular weight of 615.65 g/mol, XLogP of 7.12, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(3+);bis(2-(3,5-dimethylpyrazol-1-yl)-4-methyl-6-(4-methyl-2-pyridinyl)pyridine) is sourced from PubChem (CID 140695192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).