About bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+)
bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+) (PubChem CID 140695196) has the molecular formula C42H52CoN8+3
and a molecular weight of 727.87 g/mol. Its IUPAC name is bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+).
Molecular Properties
| Compound Name | bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+) |
| PubChem CID | 140695196 |
| Molecular Formula | C42H52CoN8+3 |
| Molecular Weight | 727.87 g/mol |
| Exact Mass | 727.36 |
| IUPAC Name | bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+) |
| SMILES | CC(C)(C)c1ccnc(-c2cc(C(C)(C)C)cc(-n3cccn3)n2)c1.CC(C)(C)c1ccnc(-c2cc(C(C)(C)C)cc(-n3cccn3)n2)c1.[Co+3] |
| InChI | InChI=1S/2C21H26N4.Co/c2*1-20(2,3)15-8-10-22-17(12-15)18-13-16(21(4,5)6)14-19(24-18)25-11-7-9-23-25;/h2*7-14H,1-6H3;/q;;+3 |
| InChIKey | GYUUZOMAJZNOQQ-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 727.87 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+)?
The IUPAC name of bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+) (CID 140695196) is bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+).
What is the SMILES notation for bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+)?
The canonical SMILES for bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+) is CC(C)(C)c1ccnc(-c2cc(C(C)(C)C)cc(-n3cccn3)n2)c1.CC(C)(C)c1ccnc(-c2cc(C(C)(C)C)cc(-n3cccn3)n2)c1.[Co+3].
What is the InChIKey of bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+)?
The InChIKey is GYUUZOMAJZNOQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C21H26N4.Co/c2*1-20(2,3)15-8-10-22-17(12-15)18-13-16(21(4,5)6)14-19(24-18)25-11-7-9-23-25;/h2*7-14H,1-6H3;/q;;+3.
What are the key properties of bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+)?
bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+) has a molecular weight of 727.87 g/mol, XLogP of 9.85, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)-6-pyrazol-1-ylpyridine);cobalt(3+) is sourced from PubChem (CID 140695196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).