C23H24ClFN4O4S — CID 140695388
4-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-fluoro-5-pyridazin-4-ylthiophene-2-carboxamide (PubChem CID 140695388) has the molecular formula C23H24ClFN4O4S and a molecular weight of 506.99 g/mol. Its IUPAC name is 4-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-fluoro-5-pyridazin-4-ylthiophene-2-carboxamide.
| Compound Name | 4-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-fluoro-5-pyridazin-4-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 140695388 |
| Molecular Formula | C23H24ClFN4O4S |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 4-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-fluoro-5-pyridazin-4-ylthiophene-2-carboxamide |
| SMILES | NC(=O)c1sc(-c2ccnnc2)c([C@@H](C(=O)N2C[C@H](Cl)[C@H]3OCC(=O)[C@H]32)C2CCCCC2)c1F |
| InChI | InChI=1S/C23H24ClFN4O4S/c24-13-9-29(18-14(30)10-33-19(13)18)23(32)15(11-4-2-1-3-5-11)16-17(25)21(22(26)31)34-20(16)12-6-7-27-28-8-12/h6-8,11,13,15,18-19H,1-5,9-10H2,(H2,26,31)/t13-,15-,18+,19+/m0/s1 |
| InChIKey | HWDIBSYTJVXHFE-JECZMYCTSA-N |
| XLogP | 2.89 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|