C22H24ClN5O4S — CID 140695410
4-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyrazin-2-yl-1,3-thiazole-2-carboxamide (PubChem CID 140695410) has the molecular formula C22H24ClN5O4S and a molecular weight of 489.99 g/mol. Its IUPAC name is 4-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyrazin-2-yl-1,3-thiazole-2-carboxamide.
| Compound Name | 4-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyrazin-2-yl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 140695410 |
| Molecular Formula | C22H24ClN5O4S |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 4-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyrazin-2-yl-1,3-thiazole-2-carboxamide |
| SMILES | NC(=O)c1nc([C@@H](C(=O)N2C[C@H](Cl)[C@H]3OCC(=O)[C@H]32)C2CCCCC2)c(-c2cnccn2)s1 |
| InChI | InChI=1S/C22H24ClN5O4S/c23-12-9-28(17-14(29)10-32-18(12)17)22(31)15(11-4-2-1-3-5-11)16-19(13-8-25-6-7-26-13)33-21(27-16)20(24)30/h6-8,11-12,15,17-18H,1-5,9-10H2,(H2,24,30)/t12-,15-,17+,18+/m0/s1 |
| InChIKey | LKYBPZIHBYYVFY-PWUKJLEFSA-N |
| XLogP | 2.15 |
| TPSA | 128.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|