C12H17Cl5OS — CID 140696438
2,4-dichloro-6-(2,3,5-trichlorocyclohexyl)sulfanylcyclohexan-1-ol (PubChem CID 140696438) has the molecular formula C12H17Cl5OS and a molecular weight of 386.60 g/mol. Its IUPAC name is 2,4-dichloro-6-(2,3,5-trichlorocyclohexyl)sulfanylcyclohexan-1-ol.
| Compound Name | 2,4-dichloro-6-(2,3,5-trichlorocyclohexyl)sulfanylcyclohexan-1-ol |
|---|---|
| PubChem CID | 140696438 |
| Molecular Formula | C12H17Cl5OS |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 2,4-dichloro-6-(2,3,5-trichlorocyclohexyl)sulfanylcyclohexan-1-ol |
| SMILES | OC1C(Cl)CC(Cl)CC1SC1CC(Cl)CC(Cl)C1Cl |
| InChI | InChI=1S/C12H17Cl5OS/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h5-12,18H,1-4H2 |
| InChIKey | AEIJGHDFNMVOLQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|