C21H20O7 — CID 14069669
dimethyl 3-methoxy-2,5-dioxo-3,4-diphenylhexanedioate (PubChem CID 14069669) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is dimethyl 3-methoxy-2,5-dioxo-3,4-diphenylhexanedioate.
| Compound Name | dimethyl 3-methoxy-2,5-dioxo-3,4-diphenylhexanedioate |
|---|---|
| PubChem CID | 14069669 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | dimethyl 3-methoxy-2,5-dioxo-3,4-diphenylhexanedioate |
| SMILES | COC(=O)C(=O)C(c1ccccc1)C(OC)(C(=O)C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C21H20O7/c1-26-19(24)17(22)16(14-10-6-4-7-11-14)21(28-3,18(23)20(25)27-2)15-12-8-5-9-13-15/h4-13,16H,1-3H3 |
| InChIKey | ZUSFENFLLRDDOH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|