C17H16BrNO5 — CID 1406967
(4-bromo-2,6-dimethylphenyl) 2-(3-methyl-4-nitrophenoxy)acetate (PubChem CID 1406967) has the molecular formula C17H16BrNO5 and a molecular weight of 394.22 g/mol. Its IUPAC name is (4-bromo-2,6-dimethylphenyl) 2-(3-methyl-4-nitrophenoxy)acetate.
| Compound Name | (4-bromo-2,6-dimethylphenyl) 2-(3-methyl-4-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 1406967 |
| Molecular Formula | C17H16BrNO5 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | (4-bromo-2,6-dimethylphenyl) 2-(3-methyl-4-nitrophenoxy)acetate |
| SMILES | Cc1cc(OCC(=O)Oc2c(C)cc(Br)cc2C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16BrNO5/c1-10-8-14(4-5-15(10)19(21)22)23-9-16(20)24-17-11(2)6-13(18)7-12(17)3/h4-8H,9H2,1-3H3 |
| InChIKey | ZWSCTUMSLURXDM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|