C17H23ClN2O — CID 14069779
2-(ethylamino)-2-methyl-1-(1-prop-2-enylindol-3-yl)propan-1-one;hydrochloride (PubChem CID 14069779) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-1-(1-prop-2-enylindol-3-yl)propan-1-one;hydrochloride.
| Compound Name | 2-(ethylamino)-2-methyl-1-(1-prop-2-enylindol-3-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 14069779 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-(ethylamino)-2-methyl-1-(1-prop-2-enylindol-3-yl)propan-1-one;hydrochloride |
| SMILES | C=CCn1cc(C(=O)C(C)(C)NCC)c2ccccc21.Cl |
| InChI | InChI=1S/C17H22N2O.ClH/c1-5-11-19-12-14(13-9-7-8-10-15(13)19)16(20)17(3,4)18-6-2;/h5,7-10,12,18H,1,6,11H2,2-4H3;1H |
| InChIKey | RMITXHZVWDYDAS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|