C15H17N3O — CID 140698291
(2R,5R)-2-isocyano-6-(2-phenylethyl)-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 140698291) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is (2R,5R)-2-isocyano-6-(2-phenylethyl)-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2R,5R)-2-isocyano-6-(2-phenylethyl)-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 140698291 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (2R,5R)-2-isocyano-6-(2-phenylethyl)-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | [C-]#[N+][C@@H]1CC[C@@H]2CN1C(=O)N2CCc1ccccc1 |
| InChI | InChI=1S/C15H17N3O/c1-16-14-8-7-13-11-18(14)15(19)17(13)10-9-12-5-3-2-4-6-12/h2-6,13-14H,7-11H2/t13-,14+/m1/s1 |
| InChIKey | URQYJODPPVZLAY-KGLIPLIRSA-N |
| XLogP | 2.37 |
| TPSA | 27.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|