C40H63NO8Si — CID 140700051
[(3R,4S,6R)-2-[(2R,4R,5R,7R,8S)-1-[tert-butyl(diphenyl)silyl]oxy-4,7-dihydroxy-2,4,6,8-tetramethyldec-9-en-5-yl]oxy-4-(dimethylamino)-6-methyloxan-3-yl] methyl carbonate (PubChem CID 140700051) has the molecular formula C40H63NO8Si and a molecular weight of 714.03 g/mol. Its IUPAC name is [(3R,4S,6R)-2-[(2R,4R,5R,7R,8S)-1-[tert-butyl(diphenyl)silyl]oxy-4,7-dihydroxy-2,4,6,8-tetramethyldec-9-en-5-yl]oxy-4-(dimethylamino)-6-methyloxan-3-yl] methyl carbonate.
| Compound Name | [(3R,4S,6R)-2-[(2R,4R,5R,7R,8S)-1-[tert-butyl(diphenyl)silyl]oxy-4,7-dihydroxy-2,4,6,8-tetramethyldec-9-en-5-yl]oxy-4-(dimethylamino)-6-methyloxan-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 140700051 |
| Molecular Formula | C40H63NO8Si |
| Molecular Weight | 714.03 g/mol |
| Exact Mass | 713.43 |
| IUPAC Name | [(3R,4S,6R)-2-[(2R,4R,5R,7R,8S)-1-[tert-butyl(diphenyl)silyl]oxy-4,7-dihydroxy-2,4,6,8-tetramethyldec-9-en-5-yl]oxy-4-(dimethylamino)-6-methyloxan-3-yl] methyl carbonate |
| SMILES | C=C[C@H](C)[C@@H](O)C(C)[C@@H](OC1O[C@H](C)C[C@H](N(C)C)[C@H]1OC(=O)OC)[C@](C)(O)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H63NO8Si/c1-13-28(3)34(42)30(5)36(49-37-35(48-38(43)45-12)33(41(10)11)24-29(4)47-37)40(9,44)25-27(2)26-46-50(39(6,7)8,31-20-16-14-17-21-31)32-22-18-15-19-23-32/h13-23,27-30,33-37,42,44H,1,24-26H2,2-12H3/t27-,28+,29-,30?,33+,34-,35-,36-,37?,40-/m1/s1 |
| InChIKey | AVXHVUBJBVUWFC-SJGXXADWSA-N |
| XLogP | 5.76 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|